weezer010902 weezer010902
  • 03-11-2019
  • Chemistry
contestada

How many moles of oxygen are required to produce 4 moles of water?​

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn
maizetycorn maizetycorn
  • 03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles  H2O

Answer Link
soniaaguirre01234
soniaaguirre01234 soniaaguirre01234
  • 03-11-2019
6. How do I know? Just took the test boyy
Answer Link

Otras preguntas

Can someone explain the paranoiac-critical method? I don't understand it
C6H12 + 9 O2 -> 6 CO2 + 6H2O what is its reaction type?
The ____________ model of agenda setting focuses on the role of leaders in business, finance, media, and government.
3/4x - 7 = -1 pls explain!!
If you can solve this then you get the brainliest!
In the central nervous system is contained within these cavities except which one?
khan academy, i dont understand the concept
Which of the following sentences contains an infinitive? A. Before her state track meet, Gloria jogged to the track and looked around. B. Hannah got lost on
1. Label the different parts of the nerve cell. 2. Explain the function of each part. LABEL THE DIFFERENT PARTS OF THE NERVE CELL​
How did Mexico lose Texas?