churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

Is transposing from D to Bb up a major second?

Suri owns 100 shares in opq oil company. after looking at the firm's latest annual report, she feels good about the performance of the company, so she tells her

a nickle is about 2 millimeters thick, or 2/1000 of a meter.how many nanometers is this?

What should be done so that the expression will have a value of 10? 4 + 4 2 - 5 × 2

Using the periodic table and your knowledge of atomic structure. Would Carbon-14 have more, less or the same number of neutrons as a typical carbon atom? How do

in fall and winter the amount of sunlight the plants receive decreases. how does this affect photosynthesis

) going to the wholesale club, one can buy toothpaste at a lower cost per unit as long as one buys 6 tubes at once. this is an example of _____ and this _____ t

In a proportional relationship, how can you determine the unit rate while looking at the graph?

Suppose you wanted to implement a new routing protocol in the sdn control plane. at which layer would you implement that protocol? explain.

In paternalistic families, mothers assume the traditional role as breadwinners, which leads to interpersonal crimes such as domestic violence and simple assault