waesrxdfjk waesrxdfjk

02-05-2022
Mathematics

contestada

What is the equation of a line that has a slope of One-half and passes through point (2, –3)?

Respuesta :

26huseaid 26huseaid

02-05-2022

Answer: y = one-half x minus 4

Step-by-step explanation:

y = 1/2 x + b

-3 = 1/2 (2) + b

-3 = 1 + b

-3 - 1 = b

-4 = b

Answer Link

Otras preguntas

lance bought a square postage stamp to a mail a card to his cousin. if the stamp has 4 square centimeters.what was the dimension of one side of the stamp in cen

A company that makes hair-care products had 9,000 people try a new shampoo. Of the 9,000 people, 54 had a mild allergic reaction. What percent of the people h

(X^-3)^2(x^-2)^3 PLS SIMPLIFY?!!!

cosec(6b+pi/8)=sec(2b-pi/8)

A 13 mile race is equally split up between 5 friends. Which expression shows the distance each friend will run

what are the primary curvatures of the spine and how are they shaped

how do u slove 4n - 6 = -18

PLEASE ANSWER ASAP!! IREADY QUESTION How has m ing the quilting group changed Jada's thoughts about her friends? A)Jada understands that being away from her fri

The points (6,y) and (7,9) fall on a line with a slope of 5 . What is the value of y ?

What is the area of the larger triangle