raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

Does Landon ohse like me
Which level of consumer has access to the smallest supply of energy?
Martina has a sample of an unknown substance. She measures the substance. Its mass is 13.5 grams, and its volume is 5 cm3. Which metal might her sample be made
Which statement MOST accurately describes mutations that are generated in a gene pool? A. Mutations always enhance the phenotype in a gene pool. B. Mutat
How to find the distance between two parallel lines?
The focus on the visible world in renaissance art was called
Why do credit cards not want you to pay your balance in full? explain the costs associated with a credit card.
What are the three views about justice as written by Plato?
What is the distance between the points 8,3 and 8,-6
Explain the process of evolution by natural selection